ChemNet > CAS > 71735-21-2 (2,4-Dichloro-5-methylphenylthio)acetic acid
71735-21-2 (2,4-Dichloro-5-methylphenylthio)acetic acid
상품명칭 |
(2,4-Dichloro-5-methylphenylthio)acetic acid |
영문 이름 |
(2,4-Dichloro-5-methylphenylthio)acetic acid;((2,4-Dichloro-5-methylphenyl)thio)acetic acid; [(2,4-dichloro-5-methylphenyl)sulfanyl]acetic acid |
분자식 |
C9H8Cl2O2S |
분자량 |
251.1296 |
InChI |
InChI=1/C9H8Cl2O2S/c1-5-2-8(14-4-9(12)13)7(11)3-6(5)10/h2-3H,4H2,1H3,(H,12,13) |
cas번호 |
71735-21-2 |
EC번호 |
275-933-1 |
분자 구조 |
|
밀도 |
1.47g/cm3 |
비등점 |
371.2°C at 760 mmHg |
굴절 지수 |
1.623 |
인화점 |
178.3°C |
증기압 |
3.64E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|