71902-33-5 3,5-Difluoropyridine
상품명칭 |
3,5-Difluoropyridine |
영문 이름 |
3,5-Difluoropyridine; |
분자식 |
C5H3F2N |
분자량 |
115.0808 |
InChI |
InChI=1/C5H3F2N/c6-4-1-5(7)3-8-2-4/h1-3H |
cas번호 |
71902-33-5 |
분자 구조 |
|
밀도 |
1.263g/cm3 |
비등점 |
79.4°C at 760 mmHg |
굴절 지수 |
1.446 |
인화점 |
1.9°C |
증기압 |
98.5mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|