ChemNet > CAS > 71916-91-1 5-Chloro-2-fluorobenzyl bromide
71916-91-1 5-Chloro-2-fluorobenzyl bromide
상품명칭 |
5-Chloro-2-fluorobenzyl bromide |
영문 이름 |
5-Chloro-2-fluorobenzyl bromide; alpha-Bromo-3-chloro-6-fluorotoluene; 2-Fluoro-5-chlorobenzyl bromide; 2-(bromomethyl)-4-chloro-1-fluorobenzene |
분자식 |
C7H5BrClF |
분자량 |
223.47 |
InChI |
InChI=1/C7H5BrClF/c8-4-5-3-6(9)1-2-7(5)10/h1-3H,4H2 |
cas번호 |
71916-91-1 |
분자 구조 |
|
밀도 |
1.654g/cm3 |
비등점 |
226.7°C at 760 mmHg |
굴절 지수 |
1.561 |
인화점 |
90.9°C |
증기압 |
0.121mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
R36:Irritating to eyes.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|