ChemNet > CAS > 72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene
72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene
상품명칭 |
2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
영문 이름 |
2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene;p,p-DDE |
분자식 |
C14H8Cl4 |
분자량 |
318.02 |
InChI |
InChI=1/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H |
cas번호 |
72-55-9 |
EC번호 |
200-784-6 |
분자 구조 |
|
녹는 점 |
87-90℃ |
물 용해도 |
0.00000013 g/100 mL |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R22:Harmful if swallowed.;
R33:Danger of cummulative effects.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|