ChemNet > CAS > 720-75-2 Methyl 4-biphenylcarboxylate
720-75-2 Methyl 4-biphenylcarboxylate
| 상품명칭 |
Methyl 4-biphenylcarboxylate |
| 영문 이름 |
Methyl 4-biphenylcarboxylate; P-phenylbenzoic acid methyl ester; p-Phenylbenzoic acid-OMe; Methyl 4-Phenylbenzoate; 4-Biphenylcarboxylic acid methyl ester~Methyl 4-phenylbenzoate; methyl biphenyl-4-carboxylate; methyl 4-phenylcyclohexanecarboxylate |
| 분자식 |
C14H18O2 |
| 분자량 |
218.2915 |
| InChI |
InChI=1/C14H18O2/c1-16-14(15)13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3 |
| cas번호 |
720-75-2 |
| EC번호 |
211-954-4 |
| 분자 구조 |
|
| 밀도 |
1.048g/cm3 |
| 녹는 점 |
118℃ |
| 비등점 |
307.8°C at 760 mmHg |
| 굴절 지수 |
1.517 |
| 인화점 |
132.7°C |
| 증기압 |
0.000709mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
