ChemNet > CAS > 7209-11-2 1-(4-Bromo-2-thienyl)ethan-1-one
7209-11-2 1-(4-Bromo-2-thienyl)ethan-1-one
상품명칭 |
1-(4-Bromo-2-thienyl)ethan-1-one |
영문 이름 |
1-(4-Bromo-2-thienyl)ethan-1-one; 1-(4-bromothiophen-2-yl)ethanone; 4-bromo-2-acetylthiophene |
분자식 |
C6H5BrOS |
분자량 |
205.0723 |
InChI |
InChI=1/C6H5BrOS/c1-4(8)6-2-5(7)3-9-6/h2-3H,1H3 |
cas번호 |
7209-11-2 |
분자 구조 |
|
밀도 |
1.619g/cm3 |
비등점 |
284.4°C at 760 mmHg |
굴절 지수 |
1.583 |
인화점 |
125.8°C |
증기압 |
0.00299mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|