ChemNet > CAS > 7210-77-7 Ethyl 2,4-dimethylthiazole-5-carboxylate
7210-77-7 Ethyl 2,4-dimethylthiazole-5-carboxylate
상품명칭 |
Ethyl 2,4-dimethylthiazole-5-carboxylate |
영문 이름 |
Ethyl 2,4-dimethylthiazole-5-carboxylate;ethyl 2,4-dimethyl-1,3-thiazole-5-carboxylate |
분자식 |
C8H11NO2S |
분자량 |
185.2434 |
InChI |
InChI=1/C8H11NO2S/c1-4-11-8(10)7-5(2)9-6(3)12-7/h4H2,1-3H3 |
cas번호 |
7210-77-7 |
분자 구조 |
|
밀도 |
1.164g/cm3 |
녹는 점 |
48℃ |
비등점 |
254.341°C at 760 mmHg |
굴절 지수 |
1.525 |
인화점 |
107.622°C |
증기압 |
0.017mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|