ChemNet > CAS > 72856-73-6 2-methoxy-4-(methylthio)benzoic acid
72856-73-6 2-methoxy-4-(methylthio)benzoic acid
상품명칭 |
2-methoxy-4-(methylthio)benzoic acid |
영문 이름 |
2-methoxy-4-(methylthio)benzoic acid;4-(Methylthio)-o-anisic acid; 2-methoxy-4-(methylsulfanyl)benzoic acid |
분자식 |
C9H10O3S |
분자량 |
198.2389 |
InChI |
InChI=1/C9H10O3S/c1-12-8-5-6(13-2)3-4-7(8)9(10)11/h3-5H,1-2H3,(H,10,11) |
cas번호 |
72856-73-6 |
EC번호 |
276-948-6 |
분자 구조 |
|
밀도 |
1.29g/cm3 |
비등점 |
342.3°C at 760 mmHg |
굴절 지수 |
1.592 |
인화점 |
160.8°C |
증기압 |
2.92E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|