72936-74-4;1686-14-2;74525-43-2 alpha-Pinene oxide
상품명칭 |
alpha-Pinene oxide |
영문 이름 |
alpha-Pinene oxide; pin-2(3)-ene oxide; 2,3-epoxypinane; (1S,6S)-2,7,7-trimethyl-3-oxatricyclo[4.1.1.0~2,4~]octane |
분자식 |
C10H16O |
분자량 |
152.2334 |
InChI |
InChI=1/C10H16O/c1-9(2)6-4-7(9)10(3)8(5-6)11-10/h6-8H,4-5H2,1-3H3/t6-,7-,8?,10?/m0/s1 |
cas번호 |
72936-74-4;1686-14-2;74525-43-2 |
EC번호 |
216-869-6 |
분자 구조 |
|
밀도 |
1.027g/cm3 |
비등점 |
188.6°C at 760 mmHg |
굴절 지수 |
1.504 |
인화점 |
65.6°C |
증기압 |
0.819mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|