ChemNet > CAS > 7355-58-0 N-(2-Chloroethyl)acetamide
7355-58-0 N-(2-Chloroethyl)acetamide
| 상품명칭 |
N-(2-Chloroethyl)acetamide |
| 영문 이름 |
N-(2-Chloroethyl)acetamide;Acetamide, N-(2-chloroethyl)-; 4-04-00-00449 (Beilstein Handbook Reference); AI3-08685; BRN 1743108; NSC 30247 |
| 분자식 |
C4H8ClNO |
| 분자량 |
121.5654 |
| InChI |
InChI=1/C4H8ClNO/c1-4(7)6-3-2-5/h2-3H2,1H3,(H,6,7) |
| cas번호 |
7355-58-0 |
| EC번호 |
230-884-5 |
| 분자 구조 |
|
| 밀도 |
1.086g/cm3 |
| 비등점 |
275.6°C at 760 mmHg |
| 굴절 지수 |
1.432 |
| 인화점 |
120.4°C |
| 증기압 |
0.00506mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R33:Danger of cummulative effects.;
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
