상품명칭 |
1-Benzyl-1,2,3-triazole-4,5-dicarboxylic Acid |
영문 이름 |
1-Benzyl-1,2,3-triazole-4,5-dicarboxylic Acid;v-Triazole-4,5-dicarboxylic acid, 1-benzyl-; 1-Benzyl-1,2,3-triazole-4,5-dicarboxylic acid; 1H-1,2,3-Triazole-4,5-dicarboxylic acid, 1-(phenylmethyl)-; 4-26-00-00965 (Beilstein Handbook Reference); BRN 0029417; 1-benzyl-1H-1,2,3-triazole-4,5-dicarboxylic acid; 1-benzyl-1H-1,2,3-triazole-4,5-dicarboxylate |
분자식 |
C11H7N3O4 |
분자량 |
245.1921 |
InChI |
InChI=1/C11H9N3O4/c15-10(16)8-9(11(17)18)14(13-12-8)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,15,16)(H,17,18)/p-2 |
cas번호 |
73953-89-6 |
분자 구조 |
|
비등점 |
558.5°C at 760 mmHg |
인화점 |
291.6°C |
증기압 |
2.6E-13mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|