ChemNet > CAS > 73960-07-3 4-(Difluoromethoxy)benzaldehyde
73960-07-3 4-(Difluoromethoxy)benzaldehyde
상품명칭 |
4-(Difluoromethoxy)benzaldehyde |
영문 이름 |
4-(Difluoromethoxy)benzaldehyde; p-(Difluoromethoxy)benzaldehyde |
분자식 |
C8H6F2O2 |
분자량 |
172.1288 |
InChI |
InChI=1/C8H6F2O2/c9-8(10)12-7-3-1-6(5-11)2-4-7/h1-5,8H |
cas번호 |
73960-07-3 |
EC번호 |
277-653-5 |
분자 구조 |
|
밀도 |
1.262g/cm3 |
비등점 |
234.7°C at 760 mmHg |
굴절 지수 |
1.497 |
인화점 |
93.1°C |
증기압 |
0.0522mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|