ChemNet > CAS > 7429-37-0 trans-1,2-Dibromocyclohexane
7429-37-0 trans-1,2-Dibromocyclohexane
상품명칭 |
trans-1,2-Dibromocyclohexane |
영문 이름 |
trans-1,2-Dibromocyclohexane; Dibromocyclohexane; (1S,2S)-1,2-dibromocyclohexane |
분자식 |
C6H10Br2 |
분자량 |
241.9516 |
InChI |
InChI=1/C6H10Br2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4H2/t5-,6-/m0/s1 |
cas번호 |
7429-37-0 |
EC번호 |
231-070-2 |
분자 구조 |
|
밀도 |
1.79g/cm3 |
비등점 |
220.548°C at 760 mmHg |
굴절 지수 |
1.553 |
인화점 |
91.462°C |
증기압 |
0.166mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|