ChemNet > CAS > 7459-46-3 Triethyl 1,1,2-ethanetricarboxylate
7459-46-3 Triethyl 1,1,2-ethanetricarboxylate
상품명칭 |
Triethyl 1,1,2-ethanetricarboxylate |
영문 이름 |
Triethyl 1,1,2-ethanetricarboxylate; 1,1,2-Ethanetricarboxylic acid triethyl ester; Triethyl ethane-1,1,2-tricarboxylate; 1,1,2-Ethanetricarboxylic acid, 1,1,2-triethyl ester;
|
분자식 |
C11H18O6 |
분자량 |
246.257 |
InChI |
InChI=1/C11H18O6/c1-4-15-9(12)7-8(10(13)16-5-2)11(14)17-6-3/h8H,4-7H2,1-3H3 |
cas번호 |
7459-46-3 |
EC번호 |
231-235-9 |
분자 구조 |
|
밀도 |
1.114g/cm3 |
비등점 |
300.7°C at 760 mmHg |
굴절 지수 |
1.44 |
인화점 |
127.4°C |
증기압 |
0.0011mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|