ChemNet > CAS > 74772-17-1 3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid
74772-17-1 3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid
상품명칭 |
3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid |
영문 이름 |
3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid; |
분자식 |
C9H7NO2S |
분자량 |
193.2224 |
InChI |
InChI=1/C9H7NO2S/c11-9(12)8-7(3-6-13-8)10-4-1-2-5-10/h1-6H,(H,11,12) |
cas번호 |
74772-17-1 |
분자 구조 |
|
밀도 |
1.37g/cm3 |
녹는 점 |
174℃ |
비등점 |
377.3°C at 760 mmHg |
굴절 지수 |
1.669 |
인화점 |
182°C |
증기압 |
2.31E-06mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|