ChemNet > CAS > 7499-07-2 4-Chloro-2-methylbenzoic acid
7499-07-2 4-Chloro-2-methylbenzoic acid
상품명칭 |
4-Chloro-2-methylbenzoic acid |
영문 이름 |
4-Chloro-2-methylbenzoic acid; |
분자식 |
C8H7ClO2 |
분자량 |
170.593 |
InChI |
InChI=1/C8H7ClO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
cas번호 |
7499-07-2 |
분자 구조 |
|
밀도 |
1.31g/cm3 |
녹는 점 |
180℃ |
비등점 |
300.3°C at 760 mmHg |
굴절 지수 |
1.573 |
인화점 |
135.4°C |
증기압 |
0.000504mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|