ChemNet > CAS > 75-27-4 Bromodichloromethane
75-27-4 Bromodichloromethane
| 상품명칭 |
Bromodichloromethane |
| 영문 이름 |
Bromodichloromethane; FC-20B1 |
| 분자식 |
CHBrCl2 |
| 분자량 |
163.8286 |
| InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
| cas번호 |
75-27-4 |
| EC번호 |
200-856-7 |
| 분자 구조 |
|
| 밀도 |
2.013g/cm3 |
| 녹는 점 |
-55℃ |
| 비등점 |
89.7°C at 760 mmHg |
| 굴절 지수 |
1.503 |
| 인화점 |
1.3°C |
| 증기압 |
65.3mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
| 보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
