| 상품명칭 |
피톨 |
| 별명 |
; 2-헥사데센-1-올, 3,7,11,15-테트라메틸-; 3,7,11,15- 테트라 메틸 헥사 덱 -2- 엔 -1- 올 |
| 영문 이름 |
Phytol; 2-hexadecen-1-ol, 3,7,11,15-tetramethyl-; 3,7,11,15-Tetramethylhexadec-2-en-1-ol |
| 분자식 |
C20H40O |
| 분자량 |
296.531 |
| InChI |
InChI=1/C20H40O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19,21H,6-14,16H2,1-5H3 |
| cas번호 |
7541-49-3 |
| 분자 구조 |
|
| 밀도 |
0.845g/cm3 |
| 비등점 |
335.5°C at 760 mmHg |
| 굴절 지수 |
1.459 |
| 인화점 |
157.5°C |
| 증기압 |
8.32E-06mmHg at 25°C |
| 위험성 표시 |
Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|