ChemNet > CAS > 7560-44-3 Methyl 4-chlorocinnamate
7560-44-3 Methyl 4-chlorocinnamate
| 상품명칭 |
Methyl 4-chlorocinnamate |
| 영문 이름 |
Methyl 4-chlorocinnamate; 4-Chlorocinnamic acid methyl ester; methyl 3-(4-chlorophenyl)prop-2-enoate; methyl (2E)-3-(4-chlorophenyl)prop-2-enoate |
| 분자식 |
C10H9ClO2 |
| 분자량 |
196.6303 |
| InChI |
InChI=1/C10H9ClO2/c1-13-10(12)7-4-8-2-5-9(11)6-3-8/h2-7H,1H3/b7-4+ |
| cas번호 |
7560-44-3 |
| EC번호 |
231-451-3 |
| 분자 구조 |
|
| 밀도 |
1.211g/cm3 |
| 녹는 점 |
76-77℃ |
| 비등점 |
292.8°C at 760 mmHg |
| 굴절 지수 |
1.572 |
| 인화점 |
144.4°C |
| 증기압 |
0.0018mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
