ChemNet > CAS > 75705-21-4 4-Aminomethylphenylboronic acid hydrochloride
75705-21-4 4-Aminomethylphenylboronic acid hydrochloride
상품명칭 |
4-Aminomethylphenylboronic acid hydrochloride |
영문 이름 |
4-Aminomethylphenylboronic acid hydrochloride; [4-(aminomethyl)phenyl]boronic acid |
분자식 |
C7H10BNO2 |
분자량 |
150.9708 |
InChI |
InChI=1/C7H10BNO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4,10-11H,5,9H2 |
cas번호 |
75705-21-4 |
분자 구조 |
|
밀도 |
1.18g/cm3 |
비등점 |
337.7°C at 760 mmHg |
굴절 지수 |
1.567 |
인화점 |
158.1°C |
증기압 |
4.02E-05mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|