7581-97-7 2,3-Dichlorobutane
상품명칭 |
2,3-Dichlorobutane |
영문 이름 |
2,3-Dichlorobutane; 2,3-Dichlorobutane,mixture of dl and meso; 2,3-Dichlorobutane- dl + meso; (2S,3S)-2,3-dichlorobutane |
분자식 |
C4H8Cl2 |
분자량 |
127.0123 |
InChI |
InChI=1/C4H8Cl2/c1-3(5)4(2)6/h3-4H,1-2H3/t3-,4-/m0/s1 |
cas번호 |
7581-97-7 |
EC번호 |
231-486-4 |
분자 구조 |
|
밀도 |
1.076g/cm3 |
녹는 점 |
-80℃ |
비등점 |
110.467°C at 760 mmHg |
굴절 지수 |
1.425 |
인화점 |
18.333°C |
증기압 |
27.87mmHg at 25°C |
위험성 표시 |
F:Highly flammable;
|
리스크 규칙 |
R11:Highly flammable.;
|
보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
|
|