760-23-6 3,4-Dichloro-1-butene
상품명칭 |
3,4-Dichloro-1-butene |
영문 이름 |
3,4-Dichloro-1-butene; Dichlorobutene; 3,4-Dichlorobutene-1; 3,4-dichlorobut-1-ene |
분자식 |
C4H6Cl2 |
분자량 |
124.9964 |
InChI |
InChI=1/C4H6Cl2/c1-2-4(6)3-5/h2,4H,1,3H2 |
cas번호 |
760-23-6 |
EC번호 |
212-079-0 |
분자 구조 |
|
밀도 |
1.108g/cm3 |
녹는 점 |
-61℃ |
비등점 |
116°C at 760 mmHg |
굴절 지수 |
1.443 |
인화점 |
28.3°C |
증기압 |
22.1mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R10:Flammable.;
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|