ChemNet > CAS > 761-02-4 triethylammonium sulphamate
761-02-4 triethylammonium sulphamate
상품명칭 |
triethylammonium sulphamate |
영문 이름 |
triethylammonium sulphamate;Sulfamic acid, compd. with N,N-diethylethanamine (1:1); Sulfamic acid, compd. with triethylamine (1:1); Triethylamine sulfamate; Triethylammonium sulphamate; sulfamic acid - N,N-diethylethanamine (1:1) |
분자식 |
C6H18N2O3S |
분자량 |
198.2837 |
InChI |
InChI=1/C6H15N.H3NO3S/c1-4-7(5-2)6-3;1-5(2,3)4/h4-6H2,1-3H3;(H3,1,2,3,4) |
cas번호 |
761-02-4 |
EC번호 |
212-087-4 |
분자 구조 |
|
비등점 |
90.5°C at 760 mmHg |
인화점 |
152.2°C |
증기압 |
56.1mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|