763-32-6 3-Methyl-3-buten-1-ol
상품명칭 |
3-Methyl-3-buten-1-ol |
영문 이름 |
3-Methyl-3-buten-1-ol;Isobutenylcarbinol; 2-Methyl-1-buten-4-ol; 3-Isopentenyl alcohol; Isoprenol; Isopropenylethyl alcohol; Methallylcarbinol; NSC 122673; 3-Buten-1-ol, 3-methyl-; 3-Methylbut-3-en-1-ol |
분자식 |
C5H10O |
분자량 |
86.1323 |
InChI |
InChI=1/C5H10O/c1-5(2)3-4-6/h6H,1,3-4H2,2H3 |
cas번호 |
763-32-6 |
EC번호 |
212-110-8 |
분자 구조 |
|
밀도 |
0.832g/cm3 |
비등점 |
114.2°C at 760 mmHg |
굴절 지수 |
1.422 |
인화점 |
40.1°C |
증기압 |
10.2mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R10:Flammable.;
R36:Irritating to eyes.;
|
보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S24:Avoid contact with skin.;
|
|