ChemNet > CAS > 766-39-2 2,3-Dimethylmaleic anhydride
766-39-2 2,3-Dimethylmaleic anhydride
상품명칭 |
2,3-Dimethylmaleic anhydride |
영문 이름 |
2,3-Dimethylmaleic anhydride; 3,4-Dimethyl-2,5-furandione; 3,4-dimethylfuran-2,5-dione; 4,5-Dimethyl-1,3-Dioxa-2-Oxo-Cyclopentene; 2,3-Dimethyl maleic anhydride |
분자식 |
C6H6O3 |
분자량 |
126.11 |
InChI |
InChI=1/C6H6O3/c1-3-4(2)6(8)9-5(3)7/h1-2H3 |
cas번호 |
766-39-2 |
EC번호 |
212-165-8 |
분자 구조 |
|
밀도 |
1.236g/cm3 |
녹는 점 |
93-96℃ |
비등점 |
223°C at 760 mmHg |
굴절 지수 |
1.486 |
인화점 |
95.6°C |
증기압 |
0.0986mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R22:;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|