ChemNet > CAS > 769-40-4 2,3,5,6-tetrafluorothiophenol
769-40-4 2,3,5,6-tetrafluorothiophenol
| 상품명칭 |
2,3,5,6-tetrafluorothiophenol |
| 영문 이름 |
2,3,5,6-tetrafluorothiophenol; 2,3,5,6-Tetrafluorobenzenethiol; 2,3,5,6-tetrafluorobenzenethiolate |
| 분자식 |
C6HF4S |
| 분자량 |
181.1313 |
| InChI |
InChI=1/C6H2F4S/c7-2-1-3(8)5(10)6(11)4(2)9/h1,11H/p-1 |
| cas번호 |
769-40-4 |
| EC번호 |
212-210-1 |
| 분자 구조 |
|
| 비등점 |
152.6°C at 760 mmHg |
| 인화점 |
48.3°C |
| 증기압 |
4.45mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
