ChemNet > CAS > 7697-29-2 4-Chloro-3-methylbenzoic acid
7697-29-2 4-Chloro-3-methylbenzoic acid
| 상품명칭 |
4-Chloro-3-methylbenzoic acid |
| 영문 이름 |
4-Chloro-3-methylbenzoic acid; 3-Methyl -4-Chlorobenzoic acid; 3-methyl-4-chlorobenzoic acid; 4-CHLORO-M-TOLUIC ACID; 4-Chloro-3-toluic acid; 4-Chloro-3-Methyl |
| 분자식 |
C8H7ClO2 |
| 분자량 |
170.593 |
| InChI |
InChI=1/C8H7ClO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3,(H,10,11) |
| cas번호 |
7697-29-2 |
| 분자 구조 |
|
| 밀도 |
1.31g/cm3 |
| 비등점 |
299°C at 760 mmHg |
| 굴절 지수 |
1.573 |
| 인화점 |
134.6°C |
| 증기압 |
0.000548mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
