771-51-7 3-Indolylacetonitrile
상품명칭 |
3-Indolylacetonitrile |
영문 이름 |
3-Indolylacetonitrile; Indole-3-acetonitrile,(Indolyl-3-acetonitrile); Indolyl-3-acetonitrile; Indole-3-acetonitrile; 1H-Indole-3-acetonitrile; BETA-INDOLYLACETONITRILE; 2-(1H-INDOL-3-YL)ACETONITRILE; (1H-INDOL-3-YL)-ACETONITRILE; 3-INDOLEACETONITRILE; 3-Indole acetonitrile |
분자식 |
C10H8N2 |
분자량 |
156.18 |
InChI |
InChI=1/C10H8N2/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5H2 |
cas번호 |
771-51-7 |
EC번호 |
212-232-1 |
분자 구조 |
|
밀도 |
158 |
녹는 점 |
33-35℃ |
비등점 |
156-160℃(0.2 torr) |
굴절 지수 |
1.6085-1.6105 |
인화점 |
206℃ |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|