771-62-0 pentafluorothiophenol
상품명칭 |
pentafluorothiophenol |
영문 이름 |
pentafluorothiophenol; Pentafluorobenzenethiol |
분자식 |
C6HF5S |
분자량 |
200.12 |
InChI |
InChI=1/C6HF5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
cas번호 |
771-62-0 |
EC번호 |
212-236-3 |
분자 구조 |
|
밀도 |
1.5 |
녹는 점 |
-24℃ |
비등점 |
143℃ |
굴절 지수 |
1.463-1.465 |
인화점 |
51℃ |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R10:Flammable.;
R34:Causes burns.;
|
보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|