ChemNet > CAS > 773-01-3 2,4,6-Trimethylpyrylium tetrafluoroborate
773-01-3 2,4,6-Trimethylpyrylium tetrafluoroborate
상품명칭 |
2,4,6-Trimethylpyrylium tetrafluoroborate |
영문 이름 |
2,4,6-Trimethylpyrylium tetrafluoroborate;Pyrylium, 2,4,6-trimethyl-, tetrafluoroborate(1-) (1:1); 2,4,6-Trimethylpyrylium tetrafluoborate; AI3-61775; Pyrylium, 2,4,6-trimethyl-, tetrafluoroborate(1-); 2,4,6-trimethylpyranium; 2,4,6-trimethylpyranium tetrafluoroborate |
분자식 |
C8H11BF4O |
분자량 |
209.977 |
InChI |
InChI=1/C8H11O.BF4/c1-6-4-7(2)9-8(3)5-6;2-1(3,4)5/h4-5H,1-3H3;/q+1;-1 |
cas번호 |
773-01-3 |
EC번호 |
212-256-2 |
분자 구조 |
|
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|