77337-82-7 2-Bromo-5-nitroanisole
상품명칭 |
2-Bromo-5-nitroanisole |
영문 이름 |
2-Bromo-5-nitroanisole; 4-Bromo-3-methoxynitrobenzene; 1-bromo-2-methoxy-4-nitrobenzene |
분자식 |
C7H6BrNO3 |
분자량 |
232.0314 |
InChI |
InChI=1/C7H6BrNO3/c1-12-7-4-5(9(10)11)2-3-6(7)8/h2-4H,1H3 |
cas번호 |
77337-82-7 |
EC번호 |
278-669-5 |
분자 구조 |
|
밀도 |
1.64g/cm3 |
녹는 점 |
103℃ |
비등점 |
302.1°C at 760 mmHg |
굴절 지수 |
1.581 |
인화점 |
136.5°C |
증기압 |
0.00181mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|