ChemNet > CAS > 7745-92-8 2-Iodo-4-nitrotoluene
7745-92-8 2-Iodo-4-nitrotoluene
| 상품명칭 |
2-Iodo-4-nitrotoluene |
| 영문 이름 |
2-Iodo-4-nitrotoluene; 1-Nitro-3-iodo-4-methylbenzene |
| 분자식 |
C7H6INO2 |
| 분자량 |
263.03 |
| InChI |
InChI=1/C7H6INO2/c1-5-2-3-6(9(10)11)4-7(5)8/h2-4H,1H3 |
| cas번호 |
7745-92-8 |
| EC번호 |
231-808-3 |
| 분자 구조 |
|
| 녹는 점 |
60-62℃ |
| 비등점 |
164-165℃(15 torr) |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
