ChemNet > CAS > 784-04-3 9-Acetylanthracene
784-04-3 9-Acetylanthracene
상품명칭 |
9-Acetylanthracene |
영문 이름 |
9-Acetylanthracene; 9-Anthryl methyl ketone; 1-(anthracen-9-yl)ethanone |
분자식 |
C16H12O |
분자량 |
220.2659 |
InChI |
InChI=1/C16H12O/c1-11(17)16-14-8-4-2-6-12(14)10-13-7-3-5-9-15(13)16/h2-10H,1H3 |
cas번호 |
784-04-3 |
EC번호 |
212-315-2 |
분자 구조 |
|
밀도 |
1.164g/cm3 |
녹는 점 |
72-76℃ |
비등점 |
405.9°C at 760 mmHg |
굴절 지수 |
1.685 |
인화점 |
180.7°C |
증기압 |
8.47E-07mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|