ChemNet > CAS > 78583-81-0 3-(4-chlorophenyl)-1H-pyrazol-5-amine
78583-81-0 3-(4-chlorophenyl)-1H-pyrazol-5-amine
상품명칭 |
3-(4-chlorophenyl)-1H-pyrazol-5-amine |
영문 이름 |
3-(4-chlorophenyl)-1H-pyrazol-5-amine; 5-(4-chlorophenyl)-1H-pyrazol-3-amine |
분자식 |
C9H8ClN3 |
분자량 |
193.6329 |
InChI |
InChI=1/C9H8ClN3/c10-7-3-1-6(2-4-7)8-5-9(11)13-12-8/h1-5H,(H3,11,12,13) |
cas번호 |
78583-81-0 |
분자 구조 |
|
밀도 |
1.378g/cm3 |
녹는 점 |
172℃ |
비등점 |
463.8°C at 760 mmHg |
굴절 지수 |
1.67 |
인화점 |
234.3°C |
증기압 |
8.78E-09mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|