ChemNet > CAS > 78881-21-7 4-Amino-3-methylbenzonitrile
78881-21-7 4-Amino-3-methylbenzonitrile
| 상품명칭 |
4-Amino-3-methylbenzonitrile |
| 영문 이름 |
4-Amino-3-methylbenzonitrile; 4-Amino-m-tolunitrile; 4-Cyano-o-toluidine; 3-Methyl-4-aminobenzonitrile |
| 분자식 |
C8H8N2 |
| 분자량 |
132.1625 |
| InChI |
InChI=1/C8H8N2/c1-6-4-7(5-9)2-3-8(6)10/h2-4H,10H2,1H3 |
| cas번호 |
78881-21-7 |
| 분자 구조 |
|
| 밀도 |
1.1g/cm3 |
| 비등점 |
304.5°C at 760 mmHg |
| 굴절 지수 |
1.575 |
| 인화점 |
138°C |
| 증기압 |
0.000869mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
