ChemNet > CAS > 78902-09-7 Phthalimidoacetaldehyde diethyl acetal
78902-09-7 Phthalimidoacetaldehyde diethyl acetal
| 상품명칭 |
Phthalimidoacetaldehyde diethyl acetal |
| 영문 이름 |
Phthalimidoacetaldehyde diethyl acetal; LABOTEST-BB LT00454122; 2-PHTHALIMIDOACETALDEHYDE DIETHYL ACETAL; N-(2,2-DIETHOXYETHYL)PHTHALIMIDE; 2-(2,2-diethoxyethyl)-1H-isoindole-1,3(2H)-dione; 2-(Phthalimido)acetaldehyde diethylacetal; 2-(2,2-Diethoxyethyl)isoindoline-1,3-dione |
| 분자식 |
C14H17NO4 |
| 분자량 |
263.2891 |
| InChI |
InChI=1/C14H17NO4/c1-3-18-12(19-4-2)9-15-13(16)10-7-5-6-8-11(10)14(15)17/h5-8,12H,3-4,9H2,1-2H3 |
| cas번호 |
78902-09-7 |
| 분자 구조 |
|
| 밀도 |
1.2g/cm3 |
| 녹는 점 |
72-74℃ |
| 비등점 |
372.3°C at 760 mmHg |
| 굴절 지수 |
1.541 |
| 인화점 |
179°C |
| 증기압 |
9.7E-06mmHg at 25°C |
| 위험성 표시 |
Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|