ChemNet > CAS > 79636-94-5 5-Bromo-2-ethoxybenzaldehyde
79636-94-5 5-Bromo-2-ethoxybenzaldehyde
상품명칭 |
5-Bromo-2-ethoxybenzaldehyde |
영문 이름 |
5-Bromo-2-ethoxybenzaldehyde; |
분자식 |
C9H9BrO2 |
분자량 |
229.0706 |
InChI |
InChI=1/C9H9BrO2/c1-2-12-9-4-3-8(10)5-7(9)6-11/h3-6H,2H2,1H3 |
cas번호 |
79636-94-5 |
분자 구조 |
|
밀도 |
1.451g/cm3 |
녹는 점 |
68℃ |
비등점 |
302.7°C at 760 mmHg |
굴절 지수 |
1.573 |
인화점 |
136.9°C |
증기압 |
0.000974mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|