ChemNet > CAS > 80500-27-2 4-Methyl-3-nitrobenzeneboronic acid
80500-27-2 4-Methyl-3-nitrobenzeneboronic acid
상품명칭 |
4-Methyl-3-nitrobenzeneboronic acid |
영문 이름 |
4-Methyl-3-nitrobenzeneboronic acid; 4-Methyl-3-nitrophenylboronic acid; 3-Nitro-p-tolylboronic acid; (4-methyl-3-nitrophenyl)boronic acid; 4-methyl-3-nitrophenylboronic acid; 3-Nitropheny-4-methylphenylboronic acid |
분자식 |
C7H8BNO4 |
분자량 |
180.9537 |
InChI |
InChI=1/C7H8BNO4/c1-5-2-3-6(8(10)11)4-7(5)9(12)13/h2-4,10-11H,1H3 |
cas번호 |
80500-27-2 |
분자 구조 |
|
밀도 |
1.33g/cm3 |
녹는 점 |
265-270 °C(lit.) |
비등점 |
356.7°C at 760 mmHg |
굴절 지수 |
1.563 |
인화점 |
169.5°C |
증기압 |
1.05E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|