ChemNet > CAS > 80866-75-7 3-Methyl-4-nitrobenzyl alcohol
80866-75-7 3-Methyl-4-nitrobenzyl alcohol
상품명칭 |
3-Methyl-4-nitrobenzyl alcohol |
영문 이름 |
3-Methyl-4-nitrobenzyl alcohol; (3-methyl-4-nitrophenyl)methanol |
분자식 |
C8H9NO3 |
분자량 |
167.162 |
InChI |
InChI=1/C8H9NO3/c1-6-4-7(5-10)2-3-8(6)9(11)12/h2-4,10H,5H2,1H3 |
cas번호 |
80866-75-7 |
EC번호 |
279-578-3 |
분자 구조 |
|
밀도 |
1.272g/cm3 |
녹는 점 |
56-60℃ |
비등점 |
322.6°C at 760 mmHg |
굴절 지수 |
1.585 |
인화점 |
145.2°C |
증기압 |
0.000114mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|