ChemNet > CAS > 80866-80-4 2-Chloro-5-nitrobenzyl alcohol
80866-80-4 2-Chloro-5-nitrobenzyl alcohol
상품명칭 |
2-Chloro-5-nitrobenzyl alcohol |
영문 이름 |
2-Chloro-5-nitrobenzyl alcohol;(2-chloro-5-nitrophenyl)methanol |
분자식 |
C7H6ClNO3 |
분자량 |
187.5804 |
InChI |
InChI=1/C7H6ClNO3/c8-7-2-1-6(9(11)12)3-5(7)4-10/h1-3,10H,4H2 |
cas번호 |
80866-80-4 |
EC번호 |
279-584-6 |
분자 구조 |
|
밀도 |
1.476g/cm3 |
녹는 점 |
74-79℃ |
비등점 |
344.1°C at 760 mmHg |
굴절 지수 |
1.611 |
인화점 |
161.9°C |
증기압 |
2.56E-05mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|