ChemNet > CAS > 81452-54-2 Methyl 3-methylthiophene-2-carboxylate
81452-54-2 Methyl 3-methylthiophene-2-carboxylate
상품명칭 |
Methyl 3-methylthiophene-2-carboxylate |
영문 이름 |
Methyl 3-methylthiophene-2-carboxylate; 3-Methylthiophene-2-carboxylic acid methyl ester; Methyl-3-methylthiophene-2-carboxylate |
분자식 |
C7H8O2S |
분자량 |
156.2022 |
InChI |
InChI=1/C7H8O2S/c1-5-3-4-10-6(5)7(8)9-2/h3-4H,1-2H3 |
cas번호 |
81452-54-2 |
분자 구조 |
|
밀도 |
1.173g/cm3 |
비등점 |
211°C at 760 mmHg |
굴절 지수 |
1.531 |
인화점 |
81.4°C |
증기압 |
0.186mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|