815-68-9 Triacetylmethane
상품명칭 |
Triacetylmethane |
영문 이름 |
Triacetylmethane; methine triacetate; 3-acetylpentane-2,4-dione; 3-(1-hydroxyethylidene)pentane-2,4-dione |
분자식 |
C7H10O3 |
분자량 |
142.1525 |
InChI |
InChI=1/C7H10O3/c1-4(8)7(5(2)9)6(3)10/h8H,1-3H3 |
cas번호 |
815-68-9 |
EC번호 |
212-422-4 |
분자 구조 |
|
밀도 |
1.101g/cm3 |
비등점 |
298.3°C at 760 mmHg |
굴절 지수 |
1.467 |
인화점 |
148.4°C |
증기압 |
0.000129mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|