ChemNet > CAS > 81633-29-6 ethyl 2-amino-4-methylpyrimidine-5-carboxylate
81633-29-6 ethyl 2-amino-4-methylpyrimidine-5-carboxylate
| 상품명칭 |
ethyl 2-amino-4-methylpyrimidine-5-carboxylate |
| 영문 이름 |
ethyl 2-amino-4-methylpyrimidine-5-carboxylate; |
| 분자식 |
C8H11N3O2 |
| 분자량 |
181.1918 |
| InChI |
InChI=1/C8H11N3O2/c1-3-13-7(12)6-4-10-8(9)11-5(6)2/h4H,3H2,1-2H3,(H2,9,10,11) |
| cas번호 |
81633-29-6 |
| 분자 구조 |
|
| 밀도 |
1.217g/cm3 |
| 녹는 점 |
220℃ |
| 비등점 |
350.5°C at 760 mmHg |
| 굴절 지수 |
1.556 |
| 인화점 |
165.8°C |
| 증기압 |
4.38E-05mmHg at 25°C |
| 위험성 표시 |
Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|