818-38-2 diethyl glutarate
상품명칭 |
diethyl glutarate |
영문 이름 |
diethyl glutarate; Diethyl glutarate, (Glutaric acid diethyl ester); Glutaric acid diethyl ester; Diethyl Pentanediate; diethyl pentanedioate |
분자식 |
C9H16O4 |
분자량 |
188.2209 |
InChI |
InChI=1/C9H16O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h3-7H2,1-2H3 |
cas번호 |
818-38-2 |
EC번호 |
212-451-2 |
분자 구조 |
|
밀도 |
1.022g/cm3 |
비등점 |
236.5°C at 760 mmHg |
굴절 지수 |
1.427 |
인화점 |
96.1°C |
증기압 |
0.0472mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|