818-88-2 mono-methyl sebacate
상품명칭 |
mono-methyl sebacate |
영문 이름 |
mono-methyl sebacate; Monomethyl sebacate~Sebacic acid monomethyl ester; Sebacic acid monomethyl ester; Methyl hydrogen sebacate (Monomethyl sebacate; Sebacic acid monomethyl ester); monomethyl sebacate; 10-methoxy-10-oxodecanoic acid |
분자식 |
C11H20O4 |
분자량 |
216.2741 |
InChI |
InChI=1/C11H20O4/c1-15-11(14)9-7-5-3-2-4-6-8-10(12)13/h2-9H2,1H3,(H,12,13) |
cas번호 |
818-88-2 |
EC번호 |
212-458-0 |
분자 구조 |
|
밀도 |
1.038g/cm3 |
녹는 점 |
41-44℃ |
비등점 |
332.5°C at 760 mmHg |
굴절 지수 |
1.453 |
인화점 |
115.4°C |
증기압 |
2.8E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|