82-22-4 1,1'-디안트리마이드
| 상품명칭 |
1,1'-디안트리마이드 |
| 별명 |
; 1,1-이미노디안트라퀴논; 1,1'-이미노디안트라센-9,10-디온 |
| 영문 이름 |
1,1'-dianthrimide; 1,1-iminodianthraquinone; 1,1'-iminodianthracene-9,10-dione |
| 분자식 |
C28H15NO4 |
| 분자량 |
429.423 |
| InChI |
InChI=1/C28H15NO4/c30-25-15-7-1-3-9-17(15)27(32)23-19(25)11-5-13-21(23)29-22-14-6-12-20-24(22)28(33)18-10-4-2-8-16(18)26(20)31/h1-14,29H |
| cas번호 |
82-22-4 |
| EC번호 |
201-405-7 |
| 분자 구조 |
|
| 밀도 |
1.456g/cm3 |
| 녹는 점 |
300℃ |
| 비등점 |
667.1°C at 760 mmHg |
| 굴절 지수 |
1.753 |
| 인화점 |
221.6°C |
| 증기압 |
1.17E-17mmHg at 25°C |
| 위험성 표시 |
Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|