823-76-7 Cyclohexyl methyl ketone
상품명칭 |
Cyclohexyl methyl ketone |
영문 이름 |
Cyclohexyl methyl ketone; Acetylcyclohexane~Hexahydroacetophenone~Methyl cyclohexyl ketone; Acetylcyclohexane; 1-cyclohexylethanone; 1-CYCLOHEXYLETHAN-1-ONE |
분자식 |
C8H14O |
분자량 |
126.1962 |
InChI |
InChI=1/C8H14O/c1-7(9)8-5-3-2-4-6-8/h8H,2-6H2,1H3 |
cas번호 |
823-76-7 |
EC번호 |
212-517-0 |
분자 구조 |
|
밀도 |
0.916g/cm3 |
비등점 |
181.5°C at 760 mmHg |
굴절 지수 |
1.448 |
인화점 |
61.4°C |
증기압 |
0.849mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|