ChemNet > CAS > 82374-34-3 Bis-(2-ethylhexyl)-sulfoxide
82374-34-3 Bis-(2-ethylhexyl)-sulfoxide
| 상품명칭 |
Bis-(2-ethylhexyl)-sulfoxide |
| 영문 이름 |
Bis-(2-ethylhexyl)-sulfoxide; Bis(2-ethylhexyl)sulfoxide; Bis(2-ethylhexyl) sulphoxide; 3,3'-(sulfinyldimethanediyl)diheptane |
| 분자식 |
C16H34OS |
| 분자량 |
274.5056 |
| InChI |
InChI=1/C16H34OS/c1-5-9-11-15(7-3)13-18(17)14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3 |
| cas번호 |
82374-34-3 |
| 분자 구조 |
|
| 밀도 |
0.906g/cm3 |
| 비등점 |
390.6°C at 760 mmHg |
| 굴절 지수 |
1.472 |
| 인화점 |
190°C |
| 증기압 |
5.9E-06mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
