ChemNet > CAS > 825-51-4 Decahydro-2-naphthol, mixture of isomers
825-51-4 Decahydro-2-naphthol, mixture of isomers
상품명칭 |
Decahydro-2-naphthol, mixture of isomers |
영문 이름 |
Decahydro-2-naphthol, mixture of isomers; Decahydro-2-naphthol; decahydronaphthalen-2-ol; (2R,4aR,8aR)-decahydronaphthalen-2-ol; (2R,4aS,8aS)-decahydronaphthalen-2-ol; (2S,4aS,8aS)-decahydronaphthalen-2-ol; (2R,4aS,8aR)-decahydronaphthalen-2-ol; (2S,4aS,8aR)-decahydronaphthalen-2-ol |
분자식 |
C10H18O |
분자량 |
154.2493 |
InChI |
InChI=1/C10H18O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h8-11H,1-7H2/t8-,9+,10-/m0/s1 |
cas번호 |
825-51-4 |
EC번호 |
212-545-3 |
분자 구조 |
|
밀도 |
0.993g/cm3 |
비등점 |
211.594°C at 760 mmHg |
굴절 지수 |
1.501 |
인화점 |
102.148°C |
증기압 |
0.041mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|