828-00-2 2,6-dimethyl-1,3-dioxan-4-ol acetate

상품명칭	2,6-dimethyl-1,3-dioxan-4-ol acetate
영문 이름	2,6-dimethyl-1,3-dioxan-4-ol acetate; 2,6-Dimethyl-1,3-dioxan-4-ol acetate,mixture of cis and trans; 2,6-dimethyl-1,3-dioxan-4-yl acetate
분자식	C₈H₁₄O₄
분자량	174.1944
InChI	InChI=1/C8H14O4/c1-5-4-8(11-6(2)9)12-7(3)10-5/h5,7-8H,4H2,1-3H3
cas번호	828-00-2
EC번호	212-579-9
분자 구조
밀도	1.08g/cm³
비등점	212.3°C at 760 mmHg
굴절 지수	1.44
인화점	83.3°C
증기압	0.174mmHg at 25°C
위험성 표시
리스크 규칙
보안 규칙